|
CAS#: 3889-07-4 Product: 9-Chloro-5,6-Dimethyl-3,4,5,6-Tetrahydro-1H-Azepino(5,4,3-cd)Indole No suppilers available for the product. |
| Name | 9-Chloro-5,6-Dimethyl-3,4,5,6-Tetrahydro-1H-Azepino(5,4,3-cd)Indole |
|---|---|
| Synonyms | Brn 4139554; 1H-Azepino(5,4,3-Cd)Indole, 3,4,5,6-Tetrahydro-9-Chloro-5,6-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.73 |
| CAS Registry Number | 3889-07-4 |
| SMILES | C3=C1C2=C(C(N(CC1)C)C)C=CC(=C2[NH]3)Cl |
| InChI | 1S/C13H15ClN2/c1-8-10-3-4-11(14)13-12(10)9(7-15-13)5-6-16(8)2/h3-4,7-8,15H,5-6H2,1-2H3 |
| InChIKey | IBPYLFAPXTXGJI-UHFFFAOYSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.792°C at 760 mmHg (Cal.) |
| Flash point | 181.678°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Chloro-5,6-Dimethyl-3,4,5,6-Tetrahydro-1H-Azepino(5,4,3-cd)Indole |