|
CAS#: 38896-23-0 Product: N-[2,4-Bis(2-Methyl-2-Propanyl)Phenyl]Acetamide No suppilers available for the product. |
| Name | N-[2,4-Bis(2-Methyl-2-Propanyl)Phenyl]Acetamide |
|---|---|
| Synonyms | Acetamide, N-[2,4-bis(1,1-dimethylethyl)phenyl]-; Acetanilide, 2,4-di-tert-butyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 |
| CAS Registry Number | 38896-23-0 |
| SMILES | O=C(Nc1ccc(cc1C(C)(C)C)C(C)(C)C)C |
| InChI | 1S/C16H25NO/c1-11(18)17-14-9-8-12(15(2,3)4)10-13(14)16(5,6)7/h8-10H,1-7H3,(H,17,18) |
| InChIKey | TZFVZDNVBBQUGM-UHFFFAOYSA-N |
| Density | 0.967g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.711°C at 760 mmHg (Cal.) |
| Flash point | 216.591°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2,4-Bis(2-Methyl-2-Propanyl)Phenyl]Acetamide |