|
CAS#: 38914-81-7 Product: 2-[4-(4-Methoxyphenyl)Butylamino]Ethanethiol Hydrochloride No suppilers available for the product. |
| Name | 2-[4-(4-Methoxyphenyl)Butylamino]Ethanethiol Hydrochloride |
|---|---|
| Synonyms | Ethanethiol, 2-(4-(P-Methoxyphenyl)Butyl)Amino-, Hydrochloride; S-2-((4-(P-Methoxyphenyl)Butyl)Amino)Ethyl Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22ClNOS |
| Molecular Weight | 275.84 |
| CAS Registry Number | 38914-81-7 |
| SMILES | [H+].C1=C(CCCCNCCS)C=CC(=C1)OC.[Cl-] |
| InChI | 1S/C13H21NOS.ClH/c1-15-13-7-5-12(6-8-13)4-2-3-9-14-10-11-16;/h5-8,14,16H,2-4,9-11H2,1H3;1H |
| InChIKey | CIDWJZPXRNBAKP-UHFFFAOYSA-N |
| Boiling point | 364.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 174.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-(4-Methoxyphenyl)Butylamino]Ethanethiol Hydrochloride |