|
CAS#: 38932-56-8 Product: 2-Chloro-6-(Phenylmethyl)Phenol No suppilers available for the product. |
| Name | 2-Chloro-6-(Phenylmethyl)Phenol |
|---|---|
| Synonyms | 2-(Benzyl)-6-Chloro-Phenol; 6-Benzyl-2-Chlorophenol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11ClO |
| Molecular Weight | 218.68 |
| CAS Registry Number | 38932-56-8 |
| EINECS | 254-193-3 |
| SMILES | C1=CC=C(Cl)C(=C1CC2=CC=CC=C2)O |
| InChI | 1S/C13H11ClO/c14-12-8-4-7-11(13(12)15)9-10-5-2-1-3-6-10/h1-8,15H,9H2 |
| InChIKey | WBPAVXSLTANIFJ-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.075°C at 760 mmHg (Cal.) |
| Flash point | 147.377°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-6-(Phenylmethyl)Phenol |