|
CAS#: 38945-27-6 Product: 2-(Carboxymethyloxy)Butanedioic Acid No suppilers available for the product. |
| Name | 2-(Carboxymethyloxy)Butanedioic Acid |
|---|---|
| Synonyms | 2-(Carboxymethyloxy)Succinic Acid; 2-(Carboxymethoxy)Butanedioic Acid; Chebi:17040 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8O7 |
| Molecular Weight | 192.13 |
| CAS Registry Number | 38945-27-6 |
| EINECS | 254-204-1 |
| SMILES | C(C(O)=O)C(C(=O)O)OCC(=O)O |
| InChI | 1S/C6H8O7/c7-4(8)1-3(6(11)12)13-2-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | CIOXZGOUEYHNBF-UHFFFAOYSA-N |
| Density | 1.625g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.73°C at 760 mmHg (Cal.) |
| Flash point | 207.632°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Carboxymethyloxy)Butanedioic Acid |