|
CAS#: 38965-27-4 Product: (17beta)-3-Oxoandrost-4-En-17-Yl 3,3-Dimethylbutanoate No suppilers available for the product. |
| Name | (17beta)-3-Oxoandrost-4-En-17-Yl 3,3-Dimethylbutanoate |
|---|---|
| Synonyms | 17β-hydroxyandrost-4-en-3-one 3,3-dimethylbutyrate |
| Molecular Structure | ![]() |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.57 |
| CAS Registry Number | 38965-27-4 |
| EINECS | 254-224-0 |
| SMILES | CC(C)(C)CC(=O)O[C@H]2CC[C@H]1[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | 1S/C25H38O3/c1-23(2,3)15-22(27)28-21-9-8-19-18-7-6-16-14-17(26)10-12-24(16,4)20(18)11-13-25(19,21)5/h14,18-21H,6-13,15H2,1-5H3/t18-,19-,20-,21-,24-,25-/m0/s1 |
| InChIKey | LVMDQTKLLVECJT-FYVXYBBASA-N |
| Density | 1.073g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.345°C at 760 mmHg (Cal.) |
| Flash point | 205.988°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (17beta)-3-Oxoandrost-4-En-17-Yl 3,3-Dimethylbutanoate |