|
CAS#: 39003-36-6 Product: 1,8-Dihydroxy-2,5-Dinitroanthracene-9,10-Dione No suppilers available for the product. |
| Name | 1,8-Dihydroxy-2,5-Dinitroanthracene-9,10-Dione |
|---|---|
| Synonyms | 1,8-Dihydroxy-2,5-Dinitro-Anthracene-9,10-Dione; 1,8-Dihydroxy-2,5-Dinitro-9,10-Anthraquinone; 9,10-Anthracenedione, 1,8-Dihydroxy-2,5-Dinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H6N2O8 |
| Molecular Weight | 330.21 |
| CAS Registry Number | 39003-36-6 |
| EINECS | 254-245-5 |
| SMILES | C1=CC(=C3C(=C1O)C(=O)C2=C(C=CC(=C2O)[N+]([O-])=O)C3=O)[N+]([O-])=O |
| InChI | 1S/C14H6N2O8/c17-8-4-3-6(15(21)22)10-11(8)14(20)9-5(12(10)18)1-2-7(13(9)19)16(23)24/h1-4,17,19H |
| InChIKey | WZFXDVLVEULHSB-UHFFFAOYSA-N |
| Density | 1.838g/cm3 (Cal.) |
|---|---|
| Boiling point | 606.137°C at 760 mmHg (Cal.) |
| Flash point | 255.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Dihydroxy-2,5-Dinitroanthracene-9,10-Dione |