|
CAS#: 39068-23-0 Product: Sodium 2-Tert-Butylphenolate No suppilers available for the product. |
| Name | Sodium 2-Tert-Butylphenolate |
|---|---|
| Synonyms | Sodium O-Tert-Butylphenolate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13NaO |
| Molecular Weight | 172.20 |
| CAS Registry Number | 39068-23-0 |
| EINECS | 254-270-1 |
| SMILES | C1=CC=CC(=C1C(C)(C)C)[O-].[Na+] |
| InChI | 1S/C10H14O.Na/c1-10(2,3)8-6-4-5-7-9(8)11;/h4-7,11H,1-3H3;/q;+1/p-1 |
| InChIKey | PMOMTYBTEMMKNI-UHFFFAOYSA-M |
| Boiling point | 221°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 98.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2-Tert-Butylphenolate |