|
CAS#: 39138-90-4 Product: 2-(4-Nitrophenoxy)Phenol No suppilers available for the product. |
| Name | 2-(4-Nitrophenoxy)Phenol |
|---|---|
| Synonyms | O-(P-Nitrophenoxy)Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 |
| CAS Registry Number | 39138-90-4 |
| EINECS | 254-313-4 |
| SMILES | C2=C(OC1=C(O)C=CC=C1)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C12H9NO4/c14-11-3-1-2-4-12(11)17-10-7-5-9(6-8-10)13(15)16/h1-8,14H |
| InChIKey | DWENVBLWYBNNSF-UHFFFAOYSA-N |
| Density | 1.358g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.487°C at 760 mmHg (Cal.) |
| Flash point | 161.536°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Nitrophenoxy)Phenol |