|
CAS#: 39209-28-4 Product: N-[(4-Nitrophenyl)Amino]Butanimidoyl Chloride No suppilers available for the product. |
| Name | N-[(4-Nitrophenyl)Amino]Butanimidoyl Chloride |
|---|---|
| Synonyms | N-[(4-Nitrophenyl)Amino]Butyrimidoyl Chloride; Brn 1842590; Butyryl Chloride, P-Nitrophenylhydrazone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 |
| CAS Registry Number | 39209-28-4 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)N\N=C(Cl)\CCC |
| InChI | 1S/C10H12ClN3O2/c1-2-3-10(11)13-12-8-4-6-9(7-5-8)14(15)16/h4-7,12H,2-3H2,1H3/b13-10- |
| InChIKey | WLDJRDGXKZWJLL-RAXLEYEMSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.852°C at 760 mmHg (Cal.) |
| Flash point | 170.828°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(4-Nitrophenyl)Amino]Butanimidoyl Chloride |