|
CAS#: 39234-82-7 Product: 4-Nitro-3-(Trifluoromethyl)Benzenethiol No suppilers available for the product. |
| Name | 4-Nitro-3-(Trifluoromethyl)Benzenethiol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H4F3NO2S |
| Molecular Weight | 223.17 |
| CAS Registry Number | 39234-82-7 |
| EINECS | 254-370-5 |
| SMILES | C1=C(S)C=CC(=C1C(F)(F)F)[N+]([O-])=O |
| InChI | 1S/C7H4F3NO2S/c8-7(9,10)5-3-4(14)1-2-6(5)11(12)13/h1-3,14H |
| InChIKey | ANUSENKLRXGUHB-UHFFFAOYSA-N |
| Density | 1.514g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.577°C at 760 mmHg (Cal.) |
| Flash point | 126.513°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-3-(Trifluoromethyl)Benzenethiol |