|
CAS#: 39247-96-6 Product: O-{2-[Acetyl(Ethyl)Amino]-6-Methyl-4-Pyrimidinyl} O,O-Diethyl Phosphorothioate No suppilers available for the product. |
| Name | O-{2-[Acetyl(Ethyl)Amino]-6-Methyl-4-Pyrimidinyl} O,O-Diethyl Phosphorothioate |
|---|---|
| Synonyms | Pirimidophos |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22N3O4PS |
| Molecular Weight | 347.37 |
| CAS Registry Number | 39247-96-6 |
| SMILES | CCN(c1nc(C)cc(OP(=S)(OCC)OCC)n1)C(C)=O |
| InChI | 1S/C13H22N3O4PS/c1-6-16(11(5)17)13-14-10(4)9-12(15-13)20-21(22,18-7-2)19-8-3/h9H,6-8H2,1-5H3 |
| InChIKey | FBFCWTCMDMUSDI-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.595°C at 760 mmHg (Cal.) |
| Flash point | 219.055°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-{2-[Acetyl(Ethyl)Amino]-6-Methyl-4-Pyrimidinyl} O,O-Diethyl Phosphorothioate |