|
CAS#: 39367-89-0 Product: N-(2-Diethylaminoethyl)-2,4,6-Trimethyl-N-(2,4,6-Trimethylphenyl)Benzamide Hydrochloride No suppilers available for the product. |
| Name | N-(2-Diethylaminoethyl)-2,4,6-Trimethyl-N-(2,4,6-Trimethylphenyl)Benzamide Hydrochloride |
|---|---|
| Synonyms | N-(2-Diethylaminoethyl)-N-Mesityl-2,4,6-Trimethyl-Benzamide Hydrochloride; C 3230; N-(2-(Diethylamino)Ethyl)-2,2',4,4',6,6'-Hexamethylbenzanilide Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C25H37ClN2O |
| Molecular Weight | 417.03 |
| CAS Registry Number | 39367-89-0 |
| SMILES | [H+].C1=C(C=C(C(=C1C)N(CCN(CC)CC)C(=O)C2=C(C=C(C=C2C)C)C)C)C.[Cl-] |
| InChI | 1S/C25H36N2O.ClH/c1-9-26(10-2)11-12-27(24-21(7)15-18(4)16-22(24)8)25(28)23-19(5)13-17(3)14-20(23)6;/h13-16H,9-12H2,1-8H3;1H |
| InChIKey | ICCGGPCHGZEKOO-UHFFFAOYSA-N |
| Boiling point | 525.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 204.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Diethylaminoethyl)-2,4,6-Trimethyl-N-(2,4,6-Trimethylphenyl)Benzamide Hydrochloride |