| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-Propenoic Acid, Polymer With 1,2-Propanediol Mono-2-Propenoate |
|---|---|
| Synonyms | Acrylic Acid; 2-Hydroxypropyl Prop-2-Enoate; Acrylic Acid; Prop-2-Enoic Acid 2-Hydroxypropyl Ester; Acrylic Acid; Acrylic Acid 2-Hydroxypropyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 39373-34-7 |
| SMILES | C(OC(=O)C=C)C(O)C.O=C(O)C=C |
| InChI | 1S/C6H10O3.C3H4O2/c1-3-6(8)9-4-5(2)7;1-2-3(4)5/h3,5,7H,1,4H2,2H3;2H,1H2,(H,4,5) |
| InChIKey | DGZIMLVEXGVYDW-UHFFFAOYSA-N |
| Boiling point | 194.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 79.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Propenoic Acid, Polymer With 1,2-Propanediol Mono-2-Propenoate |