|
CAS#: 3944-87-4 Product: 1-Chloro-2-[2-(2-Chloroethylsulfonyl)Ethylsulfonyl]Ethane No suppilers available for the product. |
| Name | 1-Chloro-2-[2-(2-Chloroethylsulfonyl)Ethylsulfonyl]Ethane |
|---|---|
| Synonyms | Wln: G2sw2sw2g; 1,2-Bis((2-Chloroethyl)Sulfonyl)Ethane; Ai3-17985 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12Cl2O4S2 |
| Molecular Weight | 283.18 |
| CAS Registry Number | 3944-87-4 |
| SMILES | C([S](CCCl)(=O)=O)C[S](CCCl)(=O)=O |
| InChI | 1S/C6H12Cl2O4S2/c7-1-3-13(9,10)5-6-14(11,12)4-2-8/h1-6H2 |
| InChIKey | FQMRVYDYXSOKHL-UHFFFAOYSA-N |
| Density | 1.472g/cm3 (Cal.) |
|---|---|
| Boiling point | 541.704°C at 760 mmHg (Cal.) |
| Flash point | 281.413°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-2-[2-(2-Chloroethylsulfonyl)Ethylsulfonyl]Ethane |