|
CAS#: 39494-12-7 Product: 3-Chloro-N-(4-Chloro-2-Methylphenyl)Propanamide No suppilers available for the product. |
| Name | 3-Chloro-N-(4-Chloro-2-Methylphenyl)Propanamide |
|---|---|
| Synonyms | 3-Chloro-N-(4-Chloro-2-Methyl-Phenyl)Propanamide; 3-Chloro-N-(4-Chloro-2-Methyl-Phenyl)Propionamide; Nsc39583 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 |
| CAS Registry Number | 39494-12-7 |
| SMILES | C1=CC(=CC(=C1NC(=O)CCCl)C)Cl |
| InChI | 1S/C10H11Cl2NO/c1-7-6-8(12)2-3-9(7)13-10(14)4-5-11/h2-3,6H,4-5H2,1H3,(H,13,14) |
| InChIKey | WTIBWAVBYMIFCW-UHFFFAOYSA-N |
| Density | 1.299g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.411°C at 760 mmHg (Cal.) |
| Flash point | 182.657°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-N-(4-Chloro-2-Methylphenyl)Propanamide |