|
CAS#: 39538-11-9 Product: Trimethylsilyl 4-[(Trimethylsilyl)Amino]Butanoate No suppilers available for the product. |
| Name | Trimethylsilyl 4-[(Trimethylsilyl)Amino]Butanoate |
|---|---|
| Synonyms | 4-Aminobutyric acid, bis-TMS; Butanoic acid, 4-amino, di-TMS |
| Molecular Structure | ![]() |
| Molecular Formula | C10H25NO2Si2 |
| Molecular Weight | 247.48 |
| CAS Registry Number | 39538-11-9 |
| SMILES | O=C(O[Si](C)(C)C)CCCN[Si](C)(C)C |
| InChI | 1S/C10H25NO2Si2/c1-14(2,3)11-9-7-8-10(12)13-15(4,5)6/h11H,7-9H2,1-6H3 |
| InChIKey | ZRQMOACDJFMJPD-UHFFFAOYSA-N |
| Density | 0.892g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.966°C at 760 mmHg (Cal.) |
| Flash point | 94.695°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl 4-[(Trimethylsilyl)Amino]Butanoate |