|
CAS#: 39572-18-4 Product: 1-[4-(Pyridin-3-Yloxy)Phenyl]Ethan-1-One No suppilers available for the product. |
| Name | 1-[4-(Pyridin-3-Yloxy)Phenyl]Ethan-1-One |
|---|---|
| Synonyms | 1-[4-(3-Pyridyloxy)Phenyl]Ethanone; 1-(4-(Pyridin-3-Yloxy)Phenyl)Ethan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 |
| CAS Registry Number | 39572-18-4 |
| EINECS | 254-527-8 |
| SMILES | C1=NC=CC=C1OC2=CC=C(C(=O)C)C=C2 |
| InChI | 1S/C13H11NO2/c1-10(15)11-4-6-12(7-5-11)16-13-3-2-8-14-9-13/h2-9H,1H3 |
| InChIKey | CLOBDYGKUVCMRD-UHFFFAOYSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.655°C at 760 mmHg (Cal.) |
| Flash point | 170.104°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[4-(Pyridin-3-Yloxy)Phenyl]Ethan-1-One |