|
CAS#: 39594-44-0 Product: 1,1'-(5-Methyl-1,3-Phenylene)Bis(1H-Pyrrole-2,5-Dione) No suppilers available for the product. |
| Name | 1,1'-(5-Methyl-1,3-Phenylene)Bis(1H-Pyrrole-2,5-Dione) |
|---|---|
| Synonyms | 1,1'-(5-methyl-1,3-phenylene)bis-1H-pyrrole-2,5-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.25 |
| CAS Registry Number | 39594-44-0 |
| EINECS | 254-535-1 |
| SMILES | O=C3/C=C\C(=O)N3c1cc(C)cc(c1)N2C(=O)/C=C\C2=O |
| InChI | 1S/C15H10N2O4/c1-9-6-10(16-12(18)2-3-13(16)19)8-11(7-9)17-14(20)4-5-15(17)21/h2-8H,1H3 |
| InChIKey | VZAIEIIAJMQYPB-UHFFFAOYSA-N |
| Density | 1.507g/cm3 (Cal.) |
|---|---|
| Boiling point | 511.767°C at 760 mmHg (Cal.) |
| Flash point | 253.387°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(5-Methyl-1,3-Phenylene)Bis(1H-Pyrrole-2,5-Dione) |