|
CAS#: 396665-48-8 Product: 4,5,6,6-Tetramethylbicyclo[3.1.0]Hex-3-En-2-One No suppilers available for the product. |
| Name | 4,5,6,6-Tetramethylbicyclo[3.1.0]Hex-3-En-2-One |
|---|---|
| Synonyms | 4,5,6,6-tetramethylbicyclo[3.1.0]hex-3-en-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 |
| CAS Registry Number | 396665-48-8 |
| SMILES | CC12C(/C)=C\C(=O)C1C2(C)C |
| InChI | 1S/C10H14O/c1-6-5-7(11)8-9(2,3)10(6,8)4/h5,8H,1-4H3 |
| InChIKey | KHHZYFPXYPZCFO-UHFFFAOYSA-N |
| Density | 1.012g/cm3 (Cal.) |
|---|---|
| Boiling point | 198.361°C at 760 mmHg (Cal.) |
| Flash point | 76.486°C (Cal.) |
| Refractive index | 1.505 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5,6,6-Tetramethylbicyclo[3.1.0]Hex-3-En-2-One |