|
CAS#: 3969-57-1 Product: (2-Methylphenyl)Arsonic Acid No suppilers available for the product. |
| Name | (2-Methylphenyl)Arsonic Acid |
|---|---|
| Synonyms | Arsonic Acid, (2-Methylphenyl)- (9Ci); Brn 2830770; Nsc 12620 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9AsO3 |
| Molecular Weight | 216.07 |
| CAS Registry Number | 3969-57-1 |
| SMILES | C1=CC=CC(=C1C)[As](O)(O)=O |
| InChI | 1S/C7H9AsO3/c1-6-4-2-3-5-7(6)8(9,10)11/h2-5H,1H3,(H2,9,10,11) |
| InChIKey | DPJPCCXYYXKLSV-UHFFFAOYSA-N |
| Boiling point | 440.703°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 234.463°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Methylphenyl)Arsonic Acid |