Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 4,4'-Azoxyanisole-D14 |
|---|---|
| Synonyms | Oxido-[2,3,5,6-Tetradeuterio-4-(Trideuteriomethoxy)Phenyl]-[2,3,5,6-Tetradeuterio-4-(Trideuteriomethoxy)Phenyl]Imino-Ammonium; Oxido-[2,3,5,6-Tetradeuterio-4-(Trideuteriomethoxy)Phenyl]-[2,3,5,6-Tetradeuterio-4-(Trideuteriomethoxy)Phenyl]Iminoammonium; Oxido-[2,3,5,6-Tetradeuterio-4-(Trideuteriomethoxy)Phenyl]-[2,3,5,6-Tetradeuterio-4-(Trideuteriomethoxy)Phenyl]Imino-Azanium |
| Molecular Structure |  |
| Molecular Formula | C14D14N2O3 |
| Molecular Weight | 272.36 |
| CAS Registry Number | 39750-11-3 |
| EINECS | 254-619-8 |
| SMILES | C1(=C(C(=C([2H])C(=C1[2H])OC([2H])([2H])[2H])[2H])[N+]([N-]C2=C(C(=C(C(=C2[2H])[2H])OC([2H])([2H])[2H])[2H])[2H])=O)[2H] |
| InChI | 1S/C14H14N2O3/c1-18-13-7-3-11(4-8-13)15-16(17)12-5-9-14(19-2)10-6-12/h3-10H,1-2H3/i1D3,2D3,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | KAEZRSFWWCTVNP-DDAUHAMOSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.945°C at 760 mmHg (Cal.) |
| Flash point | 206.566°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Azoxyanisole-D14 |