|
CAS#: 3976-34-9 Product: 1,3-Dimethyl-2-Phenylbenzene No suppilers available for the product. |
| Name | 1,3-Dimethyl-2-Phenylbenzene |
|---|---|
| Synonyms | 1,3-Dimethyl-2-Phenyl-Benzene; 1,1'-Biphenyl, 2,6-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.26 |
| CAS Registry Number | 3976-34-9 |
| SMILES | C1=CC(=CC=C1)C2=C(C=CC=C2C)C |
| InChI | 1S/C14H14/c1-11-7-6-8-12(2)14(11)13-9-4-3-5-10-13/h3-10H,1-2H3 |
| InChIKey | BGXRAGCQZCSMOT-UHFFFAOYSA-N |
| Density | 0.973g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.257°C at 760 mmHg (Cal.) |
| Flash point | 106.499°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-2-Phenylbenzene |