Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 3-(Dimethoxyphosphorylsulfanylmethyl)-5-Methoxy-1,3,4-Thiadiazol-2-One |
|---|---|
| Synonyms | 3-[(Dimethoxyphosphorylthio)Methyl]-5-Methoxy-1,3,4-Thiadiazol-2-One; Methidathion Oxon; Gs 13007 |
| Molecular Structure |  |
| Molecular Formula | C6H11N2O5PS2 |
| Molecular Weight | 286.26 |
| CAS Registry Number | 39856-16-1 |
| SMILES | C(S[P](OC)(=O)OC)N1C(SC(=N1)OC)=O |
| InChI | 1S/C6H11N2O5PS2/c1-11-5-7-8(6(9)16-5)4-15-14(10,12-2)13-3/h4H2,1-3H3 |
| InChIKey | IJJYBBGONNNPOR-UHFFFAOYSA-N |
| Density | 1.616g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.72°C at 760 mmHg (Cal.) |
| Flash point | 158.653°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Dimethoxyphosphorylsulfanylmethyl)-5-Methoxy-1,3,4-Thiadiazol-2-One |