|
CAS#: 39863-14-4 Product: 1-Bromo-2-[(2-Bromophenyl)Sulfonylmethylsulfonyl]Benzene No suppilers available for the product. |
| Name | 1-Bromo-2-[(2-Bromophenyl)Sulfonylmethylsulfonyl]Benzene |
|---|---|
| Synonyms | Nsc370364 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10Br2O4S2 |
| Molecular Weight | 454.15 |
| CAS Registry Number | 39863-14-4 |
| SMILES | C1=CC(=C(C=C1)[S](=O)(=O)C[S](=O)(C2=CC=CC=C2Br)=O)Br |
| InChI | 1S/C13H10Br2O4S2/c14-10-5-1-3-7-12(10)20(16,17)9-21(18,19)13-8-4-2-6-11(13)15/h1-8H,9H2 |
| InChIKey | WEASZDNVBVZIJR-UHFFFAOYSA-N |
| Density | 1.818g/cm3 (Cal.) |
|---|---|
| Boiling point | 635.758°C at 760 mmHg (Cal.) |
| Flash point | 338.295°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-2-[(2-Bromophenyl)Sulfonylmethylsulfonyl]Benzene |