|
CAS#: 39900-11-3 Product: 1-(2,6,6-Trimethyl-1-Cyclohex-2-Enyl)Butane-1,3-Dione No suppilers available for the product. |
| Name | 1-(2,6,6-Trimethyl-1-Cyclohex-2-Enyl)Butane-1,3-Dione |
|---|---|
| Synonyms | 1-(2,6,6-Trimethyl-2-Cyclohexen-1-Yl)Butane-1,3-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 39900-11-3 |
| EINECS | 254-691-0 |
| SMILES | C(C(=O)C1C(CCC=C1C)(C)C)C(=O)C |
| InChI | 1S/C13H20O2/c1-9-6-5-7-13(3,4)12(9)11(15)8-10(2)14/h6,12H,5,7-8H2,1-4H3 |
| InChIKey | RDXJHZKPBWOPGF-UHFFFAOYSA-N |
| Density | 0.958g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.603°C at 760 mmHg (Cal.) |
| Flash point | 107.521°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,6,6-Trimethyl-1-Cyclohex-2-Enyl)Butane-1,3-Dione |