|
CAS#: 3994-11-4 Product: (+)-Amphetamine tartrate No suppilers available for the product. |
| Name | (+)-Amphetamine tartrate |
|---|---|
| Synonyms | (2R,3R)-2,3-Dihydroxybutanedioic Acid; (1S)-1-(O-Tolyl)Ethanamine; [(1S)-1-(O-Tolyl)Ethyl]Amine; Tartaric Acid; (+)-Alpha-Methylphenethylamine Tartrate (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 |
| CAS Registry Number | 3994-11-4 |
| EINECS | 223-642-5 |
| SMILES | [C@@H](O)([C@@H](O)C(=O)O)C(=O)O.[C@@H](N)(C1=CC=CC=C1C)C |
| InChI | 1S/C9H13N.C4H6O6/c1-7-5-3-4-6-9(7)8(2)10;5-1(3(7)8)2(6)4(9)10/h3-6,8H,10H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/t8-;1-,2-/m01/s1 |
| InChIKey | ZNGUJPXCZSDFDS-YIDNRZKSSA-N |
| Boiling point | 209.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 84.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (+)-Amphetamine tartrate |