| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 1-(2,3-Dichlorophenyl)Ethanamine Hydrochloride (1:1) |
|---|---|
| Synonyms | (±)-2,3-Dichloro-α-methylbenzylamine hydrochloride; 1-(2,3-dichlorophenyl)ethanamine hcl; 2,3-Dichloro-a-methylbenzylamine hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10Cl3N |
| Molecular Weight | 226.53 |
| CAS Registry Number | 39959-66-5 |
| SMILES | CC(C1=C(C(=CC=C1)Cl)Cl)N.Cl |
| InChI | 1S/C8H9Cl2N.ClH/c1-5(11)6-3-2-4-7(9)8(6)10;/h2-5H,11H2,1H3;1H |
| InChIKey | FQTXPVLCCDQRHY-UHFFFAOYSA-N |
| solubility | Soluble to 100 mM in water and to 100 mM in DMSO |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2,3-Dichlorophenyl)Ethanamine Hydrochloride (1:1) |