|
CAS#: 39965-26-9 Product: 3-(5-Nitrofuran-2-Yl)Propanamide No suppilers available for the product. |
| Name | 3-(5-Nitrofuran-2-Yl)Propanamide |
|---|---|
| Synonyms | 3-(5-Nitro-2-Furyl)Propanamide; 3-(5-Nitro-2-Furyl)Propionamide; 2-Furanpropanamide, 5-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 |
| CAS Registry Number | 39965-26-9 |
| SMILES | C1=C(OC(=C1)CCC(=O)N)[N+]([O-])=O |
| InChI | 1S/C7H8N2O4/c8-6(10)3-1-5-2-4-7(13-5)9(11)12/h2,4H,1,3H2,(H2,8,10) |
| InChIKey | HJILMZFPPNJGAI-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.159°C at 760 mmHg (Cal.) |
| Flash point | 220.001°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(5-Nitrofuran-2-Yl)Propanamide |