Online Database of Chemicals from Around the World
|
CAS#: 39985-64-3 Product: 2-(4-Bromophenyl)-4,5,6,7-Tetrahydroisoindole-1,3-Dione No suppilers available for the product. |
| Name | 2-(4-Bromophenyl)-4,5,6,7-Tetrahydroisoindole-1,3-Dione |
|---|---|
| Synonyms | 2-(4-Bromophenyl)-4,5,6,7-Tetrahydroisoindole-1,3-Quinone; 1H-Isoindole-1,3(2H)-Dione, 2-(4-Bromophenyl)-4,5,6,7-Tetrahydro-; 2-(4-Bromophenyl)-4,5,6,7-Tetrahydro-1H-Isoindole-1,3(2H)-Dione |
| Molecular Structure |  |
| Molecular Formula | C14H12BrNO2 |
| Molecular Weight | 306.16 |
| CAS Registry Number | 39985-64-3 |
| SMILES | C3=C(N1C(C2=C(C1=O)CCCC2)=O)C=CC(=C3)Br |
| InChI | 1S/C14H12BrNO2/c15-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)14(16)18/h5-8H,1-4H2 |
| InChIKey | DEMFUFJSZCRLRV-UHFFFAOYSA-N |
| Density | 1.607g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.485°C at 760 mmHg (Cal.) |
| Flash point | 220.802°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Bromophenyl)-4,5,6,7-Tetrahydroisoindole-1,3-Dione |