|
CAS#: 40014-81-1 Product: 4-(Ethoxyphenyl)-4-Benzoquinone Imine No suppilers available for the product. |
| Name | 4-(Ethoxyphenyl)-4-Benzoquinone Imine |
|---|---|
| Synonyms | 4-(4-Ethoxyphenyl)Imino-1-Cyclohexa-2,5-Dienone; 2,5-Cyclohexadien-1-One, 4-((4-Ethoxyphenyl)Imino)-; 4-((4-Ethoxyphenyl)Imino)-2,5-Cyclohexadien-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 40014-81-1 |
| SMILES | C2=C(N=C1C=CC(=O)C=C1)C=CC(=C2)OCC |
| InChI | 1S/C14H13NO2/c1-2-17-14-9-5-12(6-10-14)15-11-3-7-13(16)8-4-11/h3-10H,2H2,1H3 |
| InChIKey | XDFSWDQEPRWWCH-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.827°C at 760 mmHg (Cal.) |
| Flash point | 156.096°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Ethoxyphenyl)-4-Benzoquinone Imine |