Online Database of Chemicals from Around the World
|
CAS#: 40027-50-7 Product: N,N-Bis(2,3-Epoxypropyl)-o-Toluidine No suppilers available for the product. |
| Name | N,N-Bis(2,3-Epoxypropyl)-o-Toluidine |
|---|---|
| Synonyms | 2-Methyl-N,N-Bis(2-Oxiranylmethyl)Aniline; Diglycidyl-(2-Methylphenyl)Amine; Diglycidyl-O-Toluidine |
| Molecular Structure |  |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 |
| CAS Registry Number | 40027-50-7 |
| EINECS | 254-755-8 |
| SMILES | C3=C(N(CC1CO1)CC2CO2)C(=CC=C3)C |
| InChI | 1S/C13H17NO2/c1-10-4-2-3-5-13(10)14(6-11-8-15-11)7-12-9-16-12/h2-5,11-12H,6-9H2,1H3 |
| InChIKey | OVEUFHOBGCSKSH-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.104°C at 760 mmHg (Cal.) |
| Flash point | 134.645°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(2,3-Epoxypropyl)-o-Toluidine |