|
CAS#: 40051-30-7 Product: 10-(3-Chloropropyl)-2-(Methylsulphonyl)-10H-Phenothiazine No suppilers available for the product. |
| Name | 10-(3-Chloropropyl)-2-(Methylsulphonyl)-10H-Phenothiazine |
|---|---|
| Synonyms | 10-(3-Chloropropyl)-2-Methylsulfonyl-Phenothiazine; 10-(3-Chloropropyl)-2-Mesyl-Phenothiazine; 10-(3-Chloropropyl)-2-(Methylsulphonyl)-10H-Phenothiazine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16ClNO2S2 |
| Molecular Weight | 353.88 |
| CAS Registry Number | 40051-30-7 |
| EINECS | 254-776-2 |
| SMILES | C1=C([S](=O)(=O)C)C=CC2=C1N(C3=C(S2)C=CC=C3)CCCCl |
| InChI | 1S/C16H16ClNO2S2/c1-22(19,20)12-7-8-16-14(11-12)18(10-4-9-17)13-5-2-3-6-15(13)21-16/h2-3,5-8,11H,4,9-10H2,1H3 |
| InChIKey | QQAJFUSAULHWQR-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 565.108°C at 760 mmHg (Cal.) |
| Flash point | 295.567°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 10-(3-Chloropropyl)-2-(Methylsulphonyl)-10H-Phenothiazine |