|
CAS#: 40072-82-0 Product: 4-Methoxy-5-[Methoxy(3-Phenyl-2-Oxiranyl)Methylene]-2(5H)-Furanone No suppilers available for the product. |
| Name | 4-Methoxy-5-[Methoxy(3-Phenyl-2-Oxiranyl)Methylene]-2(5H)-Furanone |
|---|---|
| Synonyms | NCI60_000993 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 |
| CAS Registry Number | 40072-82-0 |
| SMILES | O=C\3OC(=C(OC)C2OC2c1ccccc1)C(/OC)=C/3 |
| InChI | 1S/C15H14O5/c1-17-10-8-11(16)19-13(10)14(18-2)15-12(20-15)9-6-4-3-5-7-9/h3-8,12,15H,1-2H3 |
| InChIKey | RTNGMIUMJUOABT-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.072°C at 760 mmHg (Cal.) |
| Flash point | 223.739°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-5-[Methoxy(3-Phenyl-2-Oxiranyl)Methylene]-2(5H)-Furanone |