|
CAS#: 40112-23-0 Product: Gossypol No suppilers available for the product. |
| Name | Gossypol |
|---|---|
| Synonyms | 7-(8-Formyl-1,6,7-Trihydroxy-5-Isopropyl-3-Methyl-2-Naphthyl)-2,3,8-Trihydroxy-4-Isopropyl-6-Methyl-Naphthalene-1-Carbaldehyde; 7-(8-Formyl-1,6,7-Trihydroxy-5-Isopropyl-3-Methyl-2-Naphthyl)-2,3,8-Trihydroxy-4-Isopropyl-6-Methyl-1-Naphthalenecarboxaldehyde; 2,3,8-Trihydroxy-6-Methyl-4-Propan-2-Yl-7-(1,6,7-Trihydroxy-8-Methanoyl-3-Methyl-5-Propan-2-Yl-Naphthalen-2-Yl)Naphthalene-1-Carbaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C30H30O8 |
| Molecular Weight | 518.56 |
| CAS Registry Number | 40112-23-0 |
| SMILES | C1=C(C)C(=C(C2=C1C(=C(O)C(=C2C=O)O)C(C)C)O)C4=C(C3=C(C(=C(O)C(=C3C=O)O)C(C)C)C=C4C)O |
| InChI | 1S/C30H30O8/c1-11(2)19-15-7-13(5)21(27(35)23(15)17(9-31)25(33)29(19)37)22-14(6)8-16-20(12(3)4)30(38)26(34)18(10-32)24(16)28(22)36/h7-12,33-38H,1-6H3 |
| InChIKey | QBKSWRVVCFFDOT-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 707.9±55.0°C at 760 mmHg (Cal.) |
| Flash point | 395.9±28.0°C (Cal.) |
| solubility | Soluble to 100 mM in DMSO and to 100 mM in ethanol |
| Market Analysis Reports |
| List of Reports Available for Gossypol |