|
CAS#: 40256-87-9 Product: N-[1-Methyl-2-[3-(Trifluoromethyl)Phenyl]Ethyl]-2-(4-Nitrophenoxy)Acetamide No suppilers available for the product. |
| Name | N-[1-Methyl-2-[3-(Trifluoromethyl)Phenyl]Ethyl]-2-(4-Nitrophenoxy)Acetamide |
|---|---|
| Synonyms | N-[1-Methyl-2-[3-(Trifluoromethyl)Phenyl]Ethyl]-2-(4-Nitrophenoxy)Acetamide; 2-(4-Nitrophenoxy)-N-[1-[3-(Trifluoromethyl)Phenyl]Propan-2-Yl]Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 |
| CAS Registry Number | 40256-87-9 |
| EINECS | 254-860-9 |
| SMILES | C1=C(C=CC=C1C(F)(F)F)CC(NC(=O)COC2=CC=C([N+]([O-])=O)C=C2)C |
| InChI | 1S/C18H17F3N2O4/c1-12(9-13-3-2-4-14(10-13)18(19,20)21)22-17(24)11-27-16-7-5-15(6-8-16)23(25)26/h2-8,10,12H,9,11H2,1H3,(H,22,24) |
| InChIKey | VYKWCDLIIVCPPL-UHFFFAOYSA-N |
| Density | 1.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 553.237°C at 760 mmHg (Cal.) |
| Flash point | 288.388°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[1-Methyl-2-[3-(Trifluoromethyl)Phenyl]Ethyl]-2-(4-Nitrophenoxy)Acetamide |