|
CAS#: 4028-15-3 Product: Dinitrocyclohexane No suppilers available for the product. |
| Name | Dinitrocyclohexane |
|---|---|
| Synonyms | Cyclohexane, 1,1-Dinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 |
| CAS Registry Number | 4028-15-3 |
| SMILES | O=[N+](C1([N+](=O)[O-])CCCCC1)[O-] |
| InChI | 1S/C6H10N2O4/c9-7(10)6(8(11)12)4-2-1-3-5-6/h1-5H2 |
| InChIKey | OWJVEZJJRYZWNI-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.888°C at 760 mmHg (Cal.) |
| Flash point | 152.758°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Dinitrocyclohexane |