|
CAS#: 40290-63-9 Product: Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}phenylalanylmethioninate No suppilers available for the product. |
| Name | Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}phenylalanylmethioninate |
|---|---|
| Synonyms | tert-butoxycarbonyl-phenylalanyl-methionine methyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.53 |
| CAS Registry Number | 40290-63-9 |
| SMILES | O=C(OC)C(NC(=O)C(NC(=O)OC(C)(C)C)Cc1ccccc1)CCSC |
| InChI | 1S/C20H30N2O5S/c1-20(2,3)27-19(25)22-16(13-14-9-7-6-8-10-14)17(23)21-15(11-12-28-5)18(24)26-4/h6-10,15-16H,11-13H2,1-5H3,(H,21,23)(H,22,25) |
| InChIKey | STRFQIOAEDHQFM-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 606.276°C at 760 mmHg (Cal.) |
| Flash point | 320.464°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}phenylalanylmethioninate |