|
CAS#: 40345-75-3 Product: 2-Methyl-3-Nitro-2H-1-Benzopyran No suppilers available for the product. |
| Name | 2-Methyl-3-Nitro-2H-1-Benzopyran |
|---|---|
| Synonyms | 2-Methyl-3-Nitro-2H-1-Benzopyran; 2H-1-Benzopyran, 2-Methyl-3-Nitro-; 4-17-00-00508 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 |
| CAS Registry Number | 40345-75-3 |
| SMILES | C1=CC=CC2=C1C=C(C(O2)C)[N+](=O)[O-] |
| InChI | 1S/C10H9NO3/c1-7-9(11(12)13)6-8-4-2-3-5-10(8)14-7/h2-7H,1H3 |
| InChIKey | OVCYGDUUGRVRON-UHFFFAOYSA-N |
| Density | 1.283g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.045°C at 760 mmHg (Cal.) |
| Flash point | 147.931°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3-Nitro-2H-1-Benzopyran |