|
CAS#: 40379-72-4 Product: 2-Chlorobenzylmercapturic Acid No suppilers available for the product. |
| Name | 2-Chlorobenzylmercapturic Acid |
|---|---|
| Synonyms | (2R)-2-Acetamido-3-[(2-Chlorophenyl)Methylthio]Propanoic Acid; (2R)-2-Acetamido-3-[(2-Chlorobenzyl)Thio]Propionic Acid; O-Chlorobenzylmercapturic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14ClNO3S |
| Molecular Weight | 287.76 |
| CAS Registry Number | 40379-72-4 |
| SMILES | [C@H](C(=O)O)(NC(=O)C)CSCC1=CC=CC=C1Cl |
| InChI | 1S/C12H14ClNO3S/c1-8(15)14-11(12(16)17)7-18-6-9-4-2-3-5-10(9)13/h2-5,11H,6-7H2,1H3,(H,14,15)(H,16,17)/t11-/m0/s1 |
| InChIKey | PJUKLWCGNNDOKV-NSHDSACASA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.525°C at 760 mmHg (Cal.) |
| Flash point | 274.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chlorobenzylmercapturic Acid |