Online Database of Chemicals from Around the World
|
CAS#: 40411-76-5 Product: N-(2,6-Dinitrophenyl)-2,4-Dinitroaniline No suppilers available for the product. |
| Name | N-(2,6-Dinitrophenyl)-2,4-Dinitroaniline |
|---|---|
| Synonyms | N-(2,4-Dinitrophenyl)-2,6-Dinitro-Aniline; (2,4-Dinitrophenyl)-(2,6-Dinitrophenyl)Amine |
| Molecular Structure |  |
| Molecular Formula | C12H7N5O8 |
| Molecular Weight | 349.22 |
| CAS Registry Number | 40411-76-5 |
| EINECS | 254-908-9 |
| SMILES | C1=CC(=C(C=C1[N+]([O-])=O)[N+]([O-])=O)NC2=C(C=CC=C2[N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/C12H7N5O8/c18-14(19)7-4-5-8(11(6-7)17(24)25)13-12-9(15(20)21)2-1-3-10(12)16(22)23/h1-6,13H |
| InChIKey | FQJQUPMBCPEBJW-UHFFFAOYSA-N |
| Density | 1.722g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.612°C at 760 mmHg (Cal.) |
| Flash point | 250.514°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,6-Dinitrophenyl)-2,4-Dinitroaniline |