|
CAS#: 40452-19-5 Product: alpha-Methyl-9-Phenanthreneacetic Acid No suppilers available for the product. |
| Name | alpha-Methyl-9-Phenanthreneacetic Acid |
|---|---|
| Synonyms | 2-(9-Phenanthryl)Propanoic Acid; 2-(9-Phenanthryl)Propionic Acid; 9-Phenanthreneacetic Acid, Alpha-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 |
| CAS Registry Number | 40452-19-5 |
| SMILES | C1=C3C(=CC=C1)C2=C(C=CC=C2)C(=C3)C(C(=O)O)C |
| InChI | 1S/C17H14O2/c1-11(17(18)19)16-10-12-6-2-3-7-13(12)14-8-4-5-9-15(14)16/h2-11H,1H3,(H,18,19) |
| InChIKey | KDSPHRIFRARIST-UHFFFAOYSA-N |
| Density | 1.237g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.873°C at 760 mmHg (Cal.) |
| Flash point | 359.476°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Methyl-9-Phenanthreneacetic Acid |