|
CAS#: 40469-13-4 Product: (1R,2R)-4-Methyl-4-Cyclohexene-1,2-Dicarboxylic Acid No suppilers available for the product. |
| Name | (1R,2R)-4-Methyl-4-Cyclohexene-1,2-Dicarboxylic Acid |
|---|---|
| Synonyms | (1R,2R)-4-methylcyclohex-4-ene-1,2-dicarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 |
| CAS Registry Number | 40469-13-4 |
| SMILES | O=C(O)[C@H]1[C@H](C(=O)O)C/C=C(/C)C1 |
| InChI | 1S/C9H12O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2,6-7H,3-4H2,1H3,(H,10,11)(H,12,13)/t6-,7-/m1/s1 |
| InChIKey | YZPUIHVHPSUCHD-RNFRBKRXSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.764°C at 760 mmHg (Cal.) |
| Flash point | 205.503°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2R)-4-Methyl-4-Cyclohexene-1,2-Dicarboxylic Acid |