Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Nidroxyzone |
|---|---|
| Synonyms | 1-(2-Hydroxyethyl)-1-[(5-Nitro-2-Furyl)Methyleneamino]Urea; Nidroxyzone [Inn]; Nidroxyzonum [Inn-Latin] |
| Molecular Structure |  |
| Molecular Formula | C8H10N4O5 |
| Molecular Weight | 242.19 |
| CAS Registry Number | 405-22-1 |
| EINECS | 206-970-3 |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])\C=N\N(CCO)C(N)=O |
| InChI | 1S/C8H10N4O5/c9-8(14)11(3-4-13)10-5-6-1-2-7(17-6)12(15)16/h1-2,5,13H,3-4H2,(H2,9,14)/b10-5+ |
| InChIKey | FJVAAURIDNIYAE-BJMVGYQFSA-N |
| Density | 1.597g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.197°C at 760 mmHg (Cal.) |
| Flash point | 227.886°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nidroxyzone |