|
CAS#: 405-30-1 Product: 1-Chloro-4-[(4-Fluorophenyl)Sulfanylmethyl]Benzene No suppilers available for the product. |
| Name | 1-Chloro-4-[(4-Fluorophenyl)Sulfanylmethyl]Benzene |
|---|---|
| Synonyms | 1-Chloro-4-[[(4-Fluorophenyl)Thio]Methyl]Benzene; P-Chlorobenzyl P-Fluorophenyl Sulfide; P-Chlorobenzyl P-Fluorophenyl Sulphide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClFS |
| Molecular Weight | 252.73 |
| CAS Registry Number | 405-30-1 |
| SMILES | C1=CC(=CC=C1F)SCC2=CC=C(C=C2)Cl |
| InChI | 1S/C13H10ClFS/c14-11-3-1-10(2-4-11)9-16-13-7-5-12(15)6-8-13/h1-8H,9H2 |
| InChIKey | GBZXOIUBLKUSJR-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.514°C at 760 mmHg (Cal.) |
| Flash point | 162.761°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-[(4-Fluorophenyl)Sulfanylmethyl]Benzene |