| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | N-[3-(4-Biphenylyloxy)-3-(4-Fluorophenyl)Propyl]-N-Methylglycine |
|---|---|
| Synonyms | [405225-21-0]; {[3-(Biph |
| Molecular Structure | ![]() |
| Molecular Formula | C24H24FNO3 |
| Molecular Weight | 393.45 |
| CAS Registry Number | 405225-21-0 |
| SMILES | CN(CCC(C1=CC=C(C=C1)F)OC2=CC=C(C=C2)C3=CC=CC=C3)CC(=O)O |
| InChI | 1S/C24H24FNO3/c1-26(17-24(27)28)16-15-23(20-7-11-21(25)12-8-20)29-22-13-9-19(10-14-22)18-5-3-2-4-6-18/h2-14,23H,15-17H2,1H3,(H,27,28) |
| InChIKey | FDORQEIHOKEJNX-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 572.9±50.0°C at 760 mmHg (Cal.) |
| Flash point | 300.3±30.1°C (Cal.) |
| Refractive index | 1.587 (Cal.) |
| solubility | Soluble to 10 mM in DMSO and to 5 mM in ethanol |
| Market Analysis Reports |
| List of Reports Available for N-[3-(4-Biphenylyloxy)-3-(4-Fluorophenyl)Propyl]-N-Methylglycine |