|
CAS#: 4060-08-6 Product: 6-Deoxy-3-O-Methyl-L-Mannose No suppilers available for the product. |
| Name | 6-Deoxy-3-O-Methyl-L-Mannose |
|---|---|
| Synonyms | (2R,3R,4S,5S)-2,4,5-Trihydroxy-3-Methoxy-Hexanal; L-Mannose, 6-Deoxy-3-O-Methyl-; 3-O-Methyl-L-Rhamnose |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 |
| CAS Registry Number | 4060-08-6 |
| SMILES | [C@@H]([C@H]([C@@H](O)C)O)([C@H](C=O)O)OC |
| InChI | 1S/C7H14O5/c1-4(9)6(11)7(12-2)5(10)3-8/h3-7,9-11H,1-2H3/t4-,5-,6-,7-/m0/s1 |
| InChIKey | MPQBLCRFUYGBHE-AXMZGBSTSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.841°C at 760 mmHg (Cal.) |
| Flash point | 159.687°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Deoxy-3-O-Methyl-L-Mannose |