|
CAS#: 40620-38-0 Product: [(E)-(4-Methoxyphenyl)Diazenyl](Methyl)Malononitrile No suppilers available for the product. |
| Name | [(E)-(4-Methoxyphenyl)Diazenyl](Methyl)Malononitrile |
|---|---|
| Synonyms | 2-[(E)-(4-Methoxyphenyl)diazenyl]-2-methylmalononitrile #; Malononitrile, methyl 4-methoxyphenyldiazenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.22 |
| CAS Registry Number | 40620-38-0 |
| SMILES | N#CC(C#N)(/N=N/c1ccc(OC)cc1)C |
| InChI | 1S/C11H10N4O/c1-11(7-12,8-13)15-14-9-3-5-10(16-2)6-4-9/h3-6H,1-2H3/b15-14+ |
| InChIKey | YYJWRDXPMLLJFY-CCEZHUSRSA-N |
| Density | 1.102g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.901°C at 760 mmHg (Cal.) |
| Flash point | 148.481°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(E)-(4-Methoxyphenyl)Diazenyl](Methyl)Malononitrile |