|
CAS#: 40626-94-6 Product: N,N-Dimethyl-(1,1'-Biphenyl)-2-Amine No suppilers available for the product. |
| Name | N,N-Dimethyl-(1,1'-Biphenyl)-2-Amine |
|---|---|
| Synonyms | N,N-Dimethyl-2-Phenyl-Aniline; Dimethyl-(2-Phenylphenyl)Amine; Dimethylaminobiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 |
| CAS Registry Number | 40626-94-6 |
| SMILES | C1=CC=CC(=C1N(C)C)C2=CC=CC=C2 |
| InChI | 1S/C14H15N/c1-15(2)14-11-7-6-10-13(14)12-8-4-3-5-9-12/h3-11H,1-2H3 |
| InChIKey | KCJVTGHUUAEZOS-UHFFFAOYSA-N |
| Density | 1.024g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.644°C at 760 mmHg (Cal.) |
| Flash point | 128.961°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-(1,1'-Biphenyl)-2-Amine |