|
CAS#: 40678-91-9 Product: 3,5,6-Trimethyl-1-Phenyl-1H-Pyrrolo[2,3-d]Pyrimidine-2,4(3H,7H)-Dione No suppilers available for the product. |
| Name | 3,5,6-Trimethyl-1-Phenyl-1H-Pyrrolo[2,3-d]Pyrimidine-2,4(3H,7H)-Dione |
|---|---|
| Synonyms | 3,5,6-Trimethyl-1-Phenyl-7H-Pyrrolo[3,2-E]Pyrimidine-2,4-Quinone; 1-Phenyl-3,5,6-Trimethyl-1H-Pyrrolo(2,3-D)Pyrimidine-2,4(3H,7H)-Dione; 1H-Pyrrolo(2,3-D)Pyrimidine-2,4(3H,7H)-Dione, 1-Phenyl-3,5,6-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 |
| CAS Registry Number | 40678-91-9 |
| SMILES | C1=CC=CC=C1N2C(N(C(C3=C2[NH]C(=C3C)C)=O)C)=O |
| InChI | 1S/C15H15N3O2/c1-9-10(2)16-13-12(9)14(19)17(3)15(20)18(13)11-7-5-4-6-8-11/h4-8,16H,1-3H3 |
| InChIKey | CPFKFAYLYLBHHN-UHFFFAOYSA-N |
| Density | 1.305g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.814°C at 760 mmHg (Cal.) |
| Flash point | 250.031°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,6-Trimethyl-1-Phenyl-1H-Pyrrolo[2,3-d]Pyrimidine-2,4(3H,7H)-Dione |